CAS 1217723-41-5
:2,2-dichloro-N-[(2S,3S)-1,1,2-trideuterio-1,3-dihydroxy-3-(4-methylsulfonylphenyl)propan-2-yl]acetamide
Description:
2,2-Dichloro-N-[(2S,3S)-1,1,2-trideuterio-1,3-dihydroxy-3-(4-methylsulfonylphenyl)propan-2-yl]acetamide is a complex organic compound characterized by its specific structural features, including dichloro and deuterated groups. The presence of two chlorine atoms indicates a high degree of reactivity, particularly in nucleophilic substitution reactions. The deuterium labeling suggests applications in isotopic studies or tracing mechanisms in biochemical pathways. The compound contains a sulfonyl group, which enhances its solubility and potential interactions with biological systems. The stereochemistry, indicated by the (2S,3S) configuration, suggests that the compound may exhibit specific biological activity or selectivity due to its three-dimensional arrangement. Additionally, the presence of hydroxyl groups contributes to its polarity and potential hydrogen bonding capabilities, which can influence its pharmacokinetic properties. Overall, this compound's unique characteristics make it of interest in medicinal chemistry and research applications, particularly in the development of therapeutic agents or as a tool in biochemical studies.
Formula:C12H12Cl2D3NO5S
InChI:InChI=1/C12H15Cl2NO5S/c1-21(19,20)8-4-2-7(3-5-8)10(17)9(6-16)15-12(18)11(13)14/h2-5,9-11,16-17H,6H2,1H3,(H,15,18)/t9-,10-/s2/i6D2,9D
InChI key:InChIKey=OTVAEFIXJLOWRX-CZECYKEONA-N
SMILES:[C@@H]([C@](NC(C(Cl)Cl)=O)(C(O)([2H])[2H])[2H])(O)C1=CC=C(S(C)(=O)=O)C=C1
Synonyms:- 2,2-dichloro-N-[(2S,3S)-1,1,2-trideuterio-1,3-dihydroxy-3-(4-methylsulfonylphenyl)propan-2-yl]acetamide
- [2H3]-ent-Thiamphenicol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
ent-Thiamphenicol-d3
CAS:Controlled ProductApplications The labelled enatiomeric analogue of the antimicrobial agent Thiamphenicol (T344160).
References Gal, J. et al.: J. Pharmac. Sci., 77, 1062 (1988); Martin, J. et al.: Anal. Biochem., 96, 215 (1979);Formula:C12H12D3Cl2NO5SColor and Shape:White To Off-WhiteMolecular weight:359.24

