
CAS 1217776-54-9
:Tetrahydro-N-(2-methylcyclohexyl)-3-thiophenamine
Description:
Tetrahydro-N-(2-methylcyclohexyl)-3-thiophenamine is a chemical compound characterized by its unique structure, which includes a tetrahydro group, a thiophene ring, and an amine functional group. This compound is part of a class of organic molecules that may exhibit interesting pharmacological properties due to the presence of the thiophene moiety, which is known for its biological activity. The presence of the 2-methylcyclohexyl substituent can influence the compound's lipophilicity and steric properties, potentially affecting its interaction with biological targets. Typically, compounds like this may be investigated for their potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's solubility, stability, and reactivity would be influenced by its functional groups and overall molecular structure. Safety and handling considerations would also be important, as with any chemical substance, necessitating proper laboratory protocols to mitigate any risks associated with its use.
Formula:C11H21NS
InChI:InChI=1S/C11H21NS/c1-9-4-2-3-5-11(9)12-10-6-7-13-8-10/h9-12H,2-8H2,1H3
InChI key:InChIKey=FKTSKCUMZCBCOW-UHFFFAOYSA-N
SMILES:N(C1C(C)CCCC1)C2CCSC2
Synonyms:- 3-Thiophenamine, tetrahydro-N-(2-methylcyclohexyl)-
- Tetrahydro-N-(2-methylcyclohexyl)-3-thiophenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.