CAS 1217810-85-9

Description:

The chemical substance with the CAS number 1217810-85-9 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds with unique CAS numbers can exhibit a range of properties, including molecular weight, solubility, boiling and melting points, and reactivity, which are essential for understanding their behavior in various chemical contexts. The characteristics of a chemical substance can also include its physical state (solid, liquid, or gas), color, odor, and potential hazards associated with its use. Additionally, the compound may have applications in fields such as pharmaceuticals, materials science, or industrial processes, depending on its functional groups and molecular structure. For precise information, including safety data and specific applications, consulting specialized chemical databases or scientific literature is recommended.

Formula: C₂₃H₂₁D₅N₂O₂·ClH

InChI: InChI=1/C23H26N2O2.ClH/c26-23(27-21-16-24-13-10-18(21)11-14-24)25-15-12-17-6-4-5-9-20(17)22(25)19-7-2-1-3-8-19;/h1-9,18,21-22H,10-16H2;1H/t21-,22-;/s2/i1D,2D,3D,7D,8D;

InChI key: InChIKey=YAUBKMSXTZQZEB-UIDLLNQGNA-N

SMILES: C(O[C@@H]1C2CCN(C1)CC2)(=O)N3[C@H](C=4C(CC3)=CC=CC4)C5=C(C(=C(C(=C5[2H])[2H])[2H])[2H])[2H].Cl

(1R,3S-)Solifenacin-d5 Hydrochloride

Controlled Product

CAS: 1217810-85-9

Formula: C₂₃D₅H₂₁N₂O₂·HCl

Color and Shape: Neat

Molecular weight: 403.957

Ref: TR-S676722