CAS 121786-40-1
:(2R)-2-(Acetylamino)-4-pentenoic acid
Description:
(2R)-2-(Acetylamino)-4-pentenoic acid, with the CAS number 121786-40-1, is an organic compound characterized by its unique structure, which includes an acetylamino group and a pentenoic acid moiety. This compound features a chiral center at the second carbon, contributing to its stereochemistry. It is typically a white to off-white solid and is soluble in polar solvents due to the presence of both an amino and a carboxylic acid functional group. The acetylamino group enhances its reactivity, making it a potential intermediate in various synthetic pathways, particularly in the synthesis of pharmaceuticals or biologically active compounds. Its structural characteristics suggest it may participate in hydrogen bonding, influencing its physical properties such as melting point and solubility. Additionally, the presence of the double bond in the pentenoic acid portion may impart some degree of reactivity, allowing for further chemical modifications. Overall, this compound's unique features make it of interest in both synthetic organic chemistry and medicinal chemistry applications.
Formula:C7H11NO3
InChI:InChI=1S/C7H11NO3/c1-3-4-6(7(10)11)8-5(2)9/h3,6H,1,4H2,2H3,(H,8,9)(H,10,11)/t6-/m1/s1
InChI key:InChIKey=QTNLDKHXFVSKCF-ZCFIWIBFSA-N
SMILES:[C@@H](NC(C)=O)(CC=C)C(O)=O
Synonyms:- 4-pentenoic acid, 2-(acetylamino)-, (2R)-
- 121786-40-1
- 4-Pentenoic acid, 2-(acetylamino)-, (2R)-
- (2R)-2-(Acetylamino)-4-pentenoic acid
- 4-Pentenoic acid, 2-(acetylamino)-, (R)-
- (R)-2-Acetamido-4-pentenoic acid
- (2R)-2-Acetamidopent-4-enoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
