CAS 1217862-30-0
:α,3,4,5-Tetramethyl-1H-pyrazole-1-acetic acid
Description:
α,3,4,5-Tetramethyl-1H-pyrazole-1-acetic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features four methyl groups attached to the pyrazole ring, contributing to its hydrophobic characteristics and potentially influencing its reactivity and solubility. The presence of the acetic acid functional group introduces acidity to the molecule, allowing it to participate in various chemical reactions, including esterification and amidation. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its unique structure can lead to specific interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, solubility in organic solvents, and potential for forming derivatives are important characteristics that can be leveraged in synthetic chemistry. Overall, α,3,4,5-Tetramethyl-1H-pyrazole-1-acetic acid represents a versatile building block in organic synthesis and medicinal chemistry.
Formula:C9H14N2O2
InChI:InChI=1S/C9H14N2O2/c1-5-6(2)10-11(7(5)3)8(4)9(12)13/h8H,1-4H3,(H,12,13)
InChI key:InChIKey=BKVPPWKQOYJYEY-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C)N1C(C)=C(C)C(C)=N1
Synonyms:- 1H-Pyrazole-1-acetic acid, α,3,4,5-tetramethyl-
- α,3,4,5-Tetramethyl-1H-pyrazole-1-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.