CAS 1217862-31-1
:N-(3-Chlorophenyl)-5-(4-piperidinyl)-1,3,4-thiadiazole-2-carboxamide
Description:
N-(3-Chlorophenyl)-5-(4-piperidinyl)-1,3,4-thiadiazole-2-carboxamide is a chemical compound characterized by its unique structural features, which include a thiadiazole ring, a carboxamide functional group, and a piperidine moiety. The presence of the 3-chlorophenyl group contributes to its potential biological activity, as halogenated aromatic compounds often exhibit enhanced interactions with biological targets. This compound is typically classified as a heterocyclic organic compound due to the inclusion of nitrogen and sulfur atoms in its ring structure. Its molecular framework suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. The thiadiazole ring is known for its diverse biological activities, including antimicrobial and anti-inflammatory properties. Additionally, the piperidine group may enhance the compound's solubility and bioavailability. Overall, this compound's unique combination of functional groups and structural characteristics makes it a subject of interest for further research in drug development and related fields.
Formula:C14H15ClN4OS
InChI:InChI=1S/C14H15ClN4OS/c15-10-2-1-3-11(8-10)17-12(20)14-19-18-13(21-14)9-4-6-16-7-5-9/h1-3,8-9,16H,4-7H2,(H,17,20)
InChI key:InChIKey=FIOPWLWAIKKXSS-UHFFFAOYSA-N
SMILES:C(NC1=CC(Cl)=CC=C1)(=O)C=2SC(=NN2)C3CCNCC3
Synonyms:- 1,3,4-Thiadiazole-2-carboxamide, N-(3-chlorophenyl)-5-(4-piperidinyl)-
- N-(3-Chlorophenyl)-5-(4-piperidinyl)-1,3,4-thiadiazole-2-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.