CAS 1217862-34-4
:2-[(4-Nitro-1H-pyrazol-3-yl)thio]benzothiazole
Description:
2-[(4-Nitro-1H-pyrazol-3-yl)thio]benzothiazole is a chemical compound characterized by its unique structural features, which include a benzothiazole moiety and a 4-nitro-1H-pyrazole group linked through a thioether bond. This compound typically exhibits a yellow to orange color due to the presence of the nitro group, which can also influence its reactivity and solubility. It is likely to be soluble in organic solvents, reflecting the hydrophobic nature of the benzothiazole ring. The presence of the nitro group suggests potential for electrophilic reactivity, while the thioether linkage may impart specific chemical properties, such as increased stability or altered reactivity compared to similar compounds. Additionally, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. Overall, 2-[(4-Nitro-1H-pyrazol-3-yl)thio]benzothiazole represents a class of compounds that can be explored for various applications in medicinal chemistry and materials science.
Formula:C10H6N4O2S2
InChI:InChI=1S/C10H6N4O2S2/c15-14(16)7-5-11-13-9(7)18-10-12-6-3-1-2-4-8(6)17-10/h1-5H,(H,11,13)
InChI key:InChIKey=VEXNQJNRBJBDLX-UHFFFAOYSA-N
SMILES:S(C1=NC=2C(S1)=CC=CC2)C=3C(N(=O)=O)=CNN3
Synonyms:- Benzothiazole, 2-[(4-nitro-1H-pyrazol-3-yl)thio]-
- 2-[(4-Nitro-1H-pyrazol-3-yl)thio]benzothiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.