CymitQuimica logo

CAS 1217862-37-7

:

5-(Aminomethyl)-N-(2-fluorophenyl)-1,3,4-thiadiazole-2-carboxamide

Description:
5-(Aminomethyl)-N-(2-fluorophenyl)-1,3,4-thiadiazole-2-carboxamide is a chemical compound characterized by its unique structural features, which include a thiadiazole ring, an amine group, and a carboxamide functional group. The presence of the fluorophenyl moiety contributes to its potential biological activity and lipophilicity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxamide group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The thiadiazole ring is known for its diverse biological activities, including antimicrobial and anti-inflammatory properties. Additionally, the fluorine atom can enhance the compound's metabolic stability and bioavailability. As with many synthetic compounds, safety and handling precautions should be observed, as the toxicity and environmental impact of this substance would need to be assessed through appropriate studies.
Formula:C10H9FN4OS
InChI:InChI=1S/C10H9FN4OS/c11-6-3-1-2-4-7(6)13-9(16)10-15-14-8(5-12)17-10/h1-4H,5,12H2,(H,13,16)
InChI key:InChIKey=HOZDBNWNZSDJKA-UHFFFAOYSA-N
SMILES:C(NC1=C(F)C=CC=C1)(=O)C=2SC(CN)=NN2
Synonyms:
  • 5-(Aminomethyl)-N-(2-fluorophenyl)-1,3,4-thiadiazole-2-carboxamide
  • 1,3,4-Thiadiazole-2-carboxamide, 5-(aminomethyl)-N-(2-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.