CymitQuimica logo

CAS 1217862-43-5

:

3-[(3-Bromophenyl)amino]-2-cyclohexen-1-one

Description:
3-[(3-Bromophenyl)amino]-2-cyclohexen-1-one is an organic compound characterized by its unique structure, which includes a cyclohexenone core substituted with a 3-bromophenyl amino group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the bromine atom enhances its electrophilic character, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The cyclohexenone moiety suggests potential for conjugation and resonance, which may influence its electronic properties and reactivity. Additionally, the compound may display biological activity, making it of interest in medicinal chemistry. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of bromine, which can pose health risks. Overall, this compound represents a fascinating intersection of structural complexity and potential utility in chemical synthesis and biological applications.
Formula:C12H12BrNO
InChI:InChI=1S/C12H12BrNO/c13-9-3-1-4-10(7-9)14-11-5-2-6-12(15)8-11/h1,3-4,7-8,14H,2,5-6H2
InChI key:InChIKey=ZPRRRRKVJNWYHK-UHFFFAOYSA-N
SMILES:N(C1=CC(Br)=CC=C1)C2=CC(=O)CCC2
Synonyms:
  • 2-Cyclohexen-1-one, 3-[(3-bromophenyl)amino]-
  • 3-[(3-Bromophenyl)amino]cyclohex-2-en-1-one
  • 3-[(3-Bromophenyl)amino]-2-cyclohexen-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.