CAS 1217862-51-5
:N-(3-Chlorophenyl)-5-(3-piperidinyl)-1,3,4-thiadiazole-2-carboxamide
Description:
N-(3-Chlorophenyl)-5-(3-piperidinyl)-1,3,4-thiadiazole-2-carboxamide is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, a carboxamide functional group, and a chlorophenyl moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the piperidine group, which is often linked to pharmacological effects. The chlorophenyl group may enhance lipophilicity, influencing the compound's solubility and permeability. Thiadiazoles are known for their diverse applications in medicinal chemistry, often serving as scaffolds for drug development. The presence of the carboxamide group can contribute to hydrogen bonding capabilities, affecting the compound's interaction with biological targets. Overall, this compound may possess interesting pharmacological properties, making it a candidate for further research in drug discovery and development. However, specific characteristics such as melting point, solubility, and biological activity would require empirical data for precise evaluation.
Formula:C14H15ClN4OS
InChI:InChI=1S/C14H15ClN4OS/c15-10-4-1-5-11(7-10)17-12(20)14-19-18-13(21-14)9-3-2-6-16-8-9/h1,4-5,7,9,16H,2-3,6,8H2,(H,17,20)
InChI key:InChIKey=OSXGCFKSXGETJR-UHFFFAOYSA-N
SMILES:C(NC1=CC(Cl)=CC=C1)(=O)C=2SC(=NN2)C3CCCNC3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.