CymitQuimica logo

CAS 1217862-52-6

:

N-(4-Fluorophenyl)-5-(3-piperidinyl)-1,3,4-thiadiazole-2-carboxamide

Description:
N-(4-Fluorophenyl)-5-(3-piperidinyl)-1,3,4-thiadiazole-2-carboxamide is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, a carboxamide functional group, and a piperidine moiety. The presence of the 4-fluorophenyl group contributes to its potential biological activity, as halogenated aromatic compounds often exhibit enhanced interactions with biological targets. This compound is typically studied for its pharmacological properties, particularly in the context of drug development, where it may exhibit activity against specific diseases or conditions. Its molecular structure suggests potential for interactions with various receptors or enzymes, making it a candidate for further research in medicinal chemistry. Additionally, the thiadiazole ring is known for its diverse biological activities, including antimicrobial and anti-inflammatory properties. As with many synthetic compounds, its solubility, stability, and reactivity are important characteristics that influence its application in research and potential therapeutic uses.
Formula:C14H15FN4OS
InChI:InChI=1S/C14H15FN4OS/c15-10-3-5-11(6-4-10)17-12(20)14-19-18-13(21-14)9-2-1-7-16-8-9/h3-6,9,16H,1-2,7-8H2,(H,17,20)
InChI key:InChIKey=SZNFZUDKMIWSRV-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(F)C=C1)(=O)C=2SC(=NN2)C3CCCNC3
Synonyms:
  • 1,3,4-Thiadiazole-2-carboxamide, N-(4-fluorophenyl)-5-(3-piperidinyl)-
  • N-(4-Fluorophenyl)-5-(3-piperidinyl)-1,3,4-thiadiazole-2-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.