CAS 1217862-54-8

1,1-Dimethylethyl N-[(5-bromo-2-hydroxyphenyl)methyl]-N-(2-hydroxyethyl)carbamate

Description:

1,1-Dimethylethyl N-[(5-bromo-2-hydroxyphenyl)methyl]-N-(2-hydroxyethyl)carbamate, with the CAS number 1217862-54-8, is a chemical compound characterized by its complex structure, which includes a carbamate functional group. This compound features a branched alkyl group (1,1-dimethylethyl) that contributes to its steric hindrance, potentially influencing its reactivity and solubility. The presence of a bromine atom and a hydroxyl group on the aromatic ring suggests that it may exhibit unique electronic properties and potential biological activity. The hydroxyethyl substituent indicates that the compound may have polar characteristics, which could enhance its solubility in polar solvents. Additionally, the presence of multiple functional groups suggests that it may participate in various chemical reactions, making it of interest in medicinal chemistry and material science. Overall, this compound's specific characteristics, including its molecular weight, melting point, and solubility, would need to be determined through experimental methods for a comprehensive understanding of its properties and potential applications.

Formula: C₁₄H₂₀BrNO₄

InChI: InChI=1S/C14H20BrNO4/c1-14(2,3)20-13(19)16(6-7-17)9-10-8-11(15)4-5-12(10)18/h4-5,8,17-18H,6-7,9H2,1-3H3

InChI key: InChIKey=YFNZPSVBCBMUEW-UHFFFAOYSA-N

SMILES: C(N(C(OC(C)(C)C)=O)CCO)C1=C(O)C=CC(Br)=C1

Synonyms:

• tert-Butyl N-(5-bromo-2-hydroxybenzyl)-N-(2-hydroxyethyl)carbamate
• 1,1-Dimethylethyl N-[(5-bromo-2-hydroxyphenyl)methyl]-N-(2-hydroxyethyl)carbamate
• Carbamic acid, N-[(5-bromo-2-hydroxyphenyl)methyl]-N-(2-hydroxyethyl)-, 1,1-dimethylethyl ester

(5-Bromo-2-hydroxy-benzyl)-(2-hydroxy-ethyl)-carbamic acid tert-butyl ester

CAS: 1217862-54-8

(5-Bromo-2-hydroxy-benzyl)-(2-hydroxy-ethyl)-carbamic acid tert-butyl ester

Purity: 95%

Molecular weight: 346.22g/mol

Ref: 54-OR1004820