CAS 1217862-55-9

4-Iodo-1H-pyrazole-1-acetamide

Description:

4-Iodo-1H-pyrazole-1-acetamide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of an iodine atom at the 4-position of the pyrazole ring contributes to its reactivity and potential applications in medicinal chemistry. The acetamide functional group attached to the pyrazole enhances its solubility and may influence its biological activity. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug development and research. Additionally, the compound may possess unique properties such as specific melting and boiling points, solubility in various solvents, and reactivity with other chemical agents, which are essential for its application in synthetic chemistry and pharmacology. Safety data should be consulted for handling and storage, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact.

Formula: C₅H₆IN₃O

InChI: InChI=1S/C5H6IN3O/c6-4-1-8-9(2-4)3-5(7)10/h1-2H,3H2,(H2,7,10)

InChI key: InChIKey=WVYADYRFWCBASA-UHFFFAOYSA-N

SMILES: C(C(N)=O)N1C=C(I)C=N1

Synonyms:

• 4-Iodo-1H-pyrazole-1-acetamide
• 1H-Pyrazole-1-acetamide, 4-iodo-