CAS 1217862-56-0

1-Ethyl-4-iodo-5-methyl-1H-pyrazole

Description:

1-Ethyl-4-iodo-5-methyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which consists of two adjacent nitrogen atoms in a five-membered ring. This compound features an ethyl group at the 1-position, an iodine atom at the 4-position, and a methyl group at the 5-position of the pyrazole ring. The presence of the iodine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, including nucleophilic substitutions. The ethyl and methyl substituents contribute to the compound's hydrophobic character, influencing its solubility and interaction with biological systems. 1-Ethyl-4-iodo-5-methyl-1H-pyrazole may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its synthesis typically involves the reaction of appropriate precursors under controlled conditions. As with many halogenated compounds, safety precautions should be taken due to the potential toxicity of iodine and the reactivity of the compound. Overall, this substance is significant in research contexts, particularly in the development of new pharmaceuticals or agrochemicals.

Formula: C₆H₉IN₂

InChI: InChI=1S/C6H9IN2/c1-3-9-5(2)6(7)4-8-9/h4H,3H2,1-2H3

InChI key: InChIKey=RCIFRPWRVZPFLI-UHFFFAOYSA-N

SMILES: C(C)N1C(C)=C(I)C=N1

Synonyms:

• 1H-Pyrazole, 1-ethyl-4-iodo-5-methyl-
• 1-Ethyl-4-iodo-5-methyl-1H-pyrazole

1-ethyl-4-iodo-5-methyl-1H-pyrazole

CAS: 1217862-56-0

Formula: C₆H₉IN₂

Molecular weight: 236.056

Ref: 10-F369647