CymitQuimica logo

CAS 1217862-57-1

:

3-Cyclopropyl-4-methyl-4H-1,2,4-triazole

Description:
3-Cyclopropyl-4-methyl-4H-1,2,4-triazole is a heterocyclic organic compound characterized by its triazole ring, which consists of three nitrogen atoms and two carbon atoms. This compound features a cyclopropyl group and a methyl group, contributing to its unique structural and chemical properties. The presence of the cyclopropyl group can influence the compound's reactivity and steric properties, while the methyl group may affect its solubility and stability. 3-Cyclopropyl-4-methyl-4H-1,2,4-triazole is of interest in various fields, including medicinal chemistry, due to its potential biological activity. Compounds with triazole rings are often studied for their antifungal, antibacterial, and anticancer properties. The specific interactions and mechanisms of action of this compound would depend on its molecular structure and the functional groups present. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, and its applications could extend to agrochemicals or pharmaceuticals, depending on its efficacy in biological systems.
Formula:C6H9N3
InChI:InChI=1S/C6H9N3/c1-9-4-7-8-6(9)5-2-3-5/h4-5H,2-3H2,1H3
InChI key:InChIKey=CKCJRMRHECHTNX-UHFFFAOYSA-N
SMILES:CN1C(=NN=C1)C2CC2
Synonyms:
  • 4H-1,2,4-Triazole, 3-cyclopropyl-4-methyl-
  • 3-Cyclopropyl-4-methyl-4H-1,2,4-triazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.