CAS 1217862-62-8
:N-(4-Methylphenyl)-5-(3-piperidinyl)-1,3,4-thiadiazole-2-carboxamide
Description:
N-(4-Methylphenyl)-5-(3-piperidinyl)-1,3,4-thiadiazole-2-carboxamide is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, a carboxamide functional group, and a piperidine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the thiadiazole ring often contributes to its biological activity, as thiadiazoles are known for their diverse pharmacological properties, including antimicrobial and anti-inflammatory effects. The piperidine group may enhance the compound's ability to interact with biological targets, potentially influencing its pharmacokinetics and pharmacodynamics. Additionally, the methylphenyl substituent can affect the lipophilicity and overall stability of the molecule. Overall, this compound's structural features suggest it may have applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activity and safety profiles would require further investigation through experimental studies.
Formula:C15H18N4OS
InChI:InChI=1S/C15H18N4OS/c1-10-4-6-12(7-5-10)17-13(20)15-19-18-14(21-15)11-3-2-8-16-9-11/h4-7,11,16H,2-3,8-9H2,1H3,(H,17,20)
InChI key:InChIKey=CYJYJVJNVVPBFL-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(C)C=C1)(=O)C=2SC(=NN2)C3CCCNC3
Synonyms:- 1,3,4-Thiadiazole-2-carboxamide, N-(4-methylphenyl)-5-(3-piperidinyl)-
- N-(4-Methylphenyl)-5-(3-piperidinyl)-1,3,4-thiadiazole-2-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.