CAS 1217862-67-3
:5-(Aminomethyl)-N-phenyl-1,3,4-thiadiazole-2-carboxamide
Description:
5-(Aminomethyl)-N-phenyl-1,3,4-thiadiazole-2-carboxamide is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, an amine group, and a carboxamide functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in pharmaceutical research. The presence of the phenyl group may enhance its lipophilicity, influencing its solubility and permeability in biological systems. The thiadiazole moiety is known for its diverse applications, including antimicrobial and anti-inflammatory activities. Additionally, the amine group can participate in hydrogen bonding, which may affect the compound's interactions with biological targets. Overall, this compound's characteristics suggest potential utility in medicinal chemistry, although specific biological activities and applications would require further investigation through experimental studies.
Formula:C10H10N4OS
InChI:InChI=1S/C10H10N4OS/c11-6-8-13-14-10(16-8)9(15)12-7-4-2-1-3-5-7/h1-5H,6,11H2,(H,12,15)
InChI key:InChIKey=SJKJCOIGLQAIJR-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)(=O)C=2SC(CN)=NN2
Synonyms:- 5-(Aminomethyl)-N-phenyl-1,3,4-thiadiazole-2-carboxamide
- 1,3,4-Thiadiazole-2-carboxamide, 5-(aminomethyl)-N-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.