CAS 1217862-68-4
:N-(4-Methoxyphenyl)-5-(4-piperidinyl)-1,3,4-thiadiazole-2-carboxamide
Description:
N-(4-Methoxyphenyl)-5-(4-piperidinyl)-1,3,4-thiadiazole-2-carboxamide is a chemical compound characterized by its unique structural features, which include a thiadiazole ring, a carboxamide functional group, and a methoxy-substituted phenyl group. The presence of the piperidine moiety contributes to its potential biological activity, as piperidine derivatives are often associated with various pharmacological effects. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on its specific interactions with the solvent molecules. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. The thiadiazole ring is known for its diverse biological activities, including antimicrobial and anti-inflammatory properties. As with many synthetic compounds, the stability, reactivity, and overall behavior of this substance can be influenced by environmental factors such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C15H18N4O2S
InChI:InChI=1S/C15H18N4O2S/c1-21-12-4-2-11(3-5-12)17-13(20)15-19-18-14(22-15)10-6-8-16-9-7-10/h2-5,10,16H,6-9H2,1H3,(H,17,20)
InChI key:InChIKey=RNIVJICSUXETNY-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(OC)C=C1)(=O)C=2SC(=NN2)C3CCNCC3
Synonyms:- N-(4-Methoxyphenyl)-5-(4-piperidinyl)-1,3,4-thiadiazole-2-carboxamide
- 1,3,4-Thiadiazole-2-carboxamide, N-(4-methoxyphenyl)-5-(4-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.