CymitQuimica logo

CAS 1217862-85-5

:

4-[(Acetyloxy)methyl]-2,3,5,6-tetramethylbenzaldehyde

Description:
4-[(Acetyloxy)methyl]-2,3,5,6-tetramethylbenzaldehyde is an organic compound characterized by its complex structure, which includes a benzaldehyde moiety substituted with multiple alkyl groups and an acetyloxy functional group. This compound features a tetramethylbenzene core, indicating the presence of four methyl groups attached to the benzene ring, which contributes to its hydrophobic nature and influences its reactivity. The acetyloxy group introduces an ester functionality, enhancing the compound's potential for further chemical transformations. The presence of the aldehyde functional group suggests that it can participate in various reactions, such as nucleophilic addition or condensation. This compound may exhibit interesting properties, including potential applications in organic synthesis, fragrance formulation, or as an intermediate in the production of more complex molecules. Its specific physical properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the overall structure, which can be influenced by the steric hindrance introduced by the methyl groups.
Formula:C14H18O3
InChI:InChI=1S/C14H18O3/c1-8-10(3)14(7-17-12(5)16)11(4)9(2)13(8)6-15/h6H,7H2,1-5H3
InChI key:InChIKey=JJBGQNLMONPING-UHFFFAOYSA-N
SMILES:C(OC(C)=O)C1=C(C)C(C)=C(C=O)C(C)=C1C
Synonyms:
  • Benzaldehyde, 4-[(acetyloxy)methyl]-2,3,5,6-tetramethyl-
  • 4-[(Acetyloxy)methyl]-2,3,5,6-tetramethylbenzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.