CymitQuimica logo

CAS 1217862-90-2

:

5-Amino-3-(4-ethoxyphenyl)-4-isoxazolecarboxamide

Description:
5-Amino-3-(4-ethoxyphenyl)-4-isoxazolecarboxamide is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features an amino group (-NH2) and a carboxamide group (-C(=O)NH2), contributing to its potential as a bioactive molecule. The presence of the ethoxyphenyl substituent enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The isoxazole moiety is known for its role in various pharmacological activities, making this compound of interest in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in areas targeting specific biological pathways. The compound's CAS number, 1217862-90-2, allows for precise identification and retrieval of information in chemical databases. Overall, 5-Amino-3-(4-ethoxyphenyl)-4-isoxazolecarboxamide exemplifies the complexity and diversity of organic compounds with potential therapeutic applications.
Formula:C12H13N3O3
InChI:InChI=1S/C12H13N3O3/c1-2-17-8-5-3-7(4-6-8)10-9(11(13)16)12(14)18-15-10/h3-6H,2,14H2,1H3,(H2,13,16)
InChI key:InChIKey=SHSPGUZFWCPJBI-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C(=NOC1N)C2=CC=C(OCC)C=C2
Synonyms:
  • 4-Isoxazolecarboxamide, 5-amino-3-(4-ethoxyphenyl)-
  • 5-Amino-3-(4-ethoxyphenyl)-4-isoxazolecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.