CAS 1217862-92-4
:N-(4-Chlorophenyl)-5-(2-pyrrolidinyl)-1,3,4-thiadiazole-2-carboxamide
Description:
N-(4-Chlorophenyl)-5-(2-pyrrolidinyl)-1,3,4-thiadiazole-2-carboxamide is a chemical compound characterized by its unique structural features, which include a thiadiazole ring, a carboxamide functional group, and a chlorophenyl substituent. The presence of the pyrrolidine moiety contributes to its potential biological activity, as this cyclic amine can interact with various biological targets. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on its specific formulation and purity. Its chlorophenyl group may impart certain electronic properties, influencing its reactivity and interaction with other molecules. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological applications, which may include antimicrobial or anti-inflammatory activities. As with many thiadiazole derivatives, it may also exhibit interesting properties related to its ability to form hydrogen bonds and engage in π-π stacking interactions, which are relevant in drug design and development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C13H13ClN4OS
InChI:InChI=1S/C13H13ClN4OS/c14-8-3-5-9(6-4-8)16-11(19)13-18-17-12(20-13)10-2-1-7-15-10/h3-6,10,15H,1-2,7H2,(H,16,19)
InChI key:InChIKey=FXWSMHMUYGGGFJ-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(Cl)C=C1)(=O)C=2SC(=NN2)C3CCCN3
Synonyms:- N-(4-Chlorophenyl)-5-(2-pyrrolidinyl)-1,3,4-thiadiazole-2-carboxamide
- 1,3,4-Thiadiazole-2-carboxamide, N-(4-chlorophenyl)-5-(2-pyrrolidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.