CAS 1217862-95-7

3-Hydroxy-1-piperidineacetic acid

Description:

3-Hydroxy-1-piperidineacetic acid, identified by its CAS number 1217862-95-7, is a chemical compound characterized by the presence of a piperidine ring and a hydroxyl group attached to an acetic acid moiety. This compound typically exhibits properties associated with both amines and carboxylic acids, which may influence its solubility and reactivity. It is likely to be soluble in polar solvents due to the presence of the hydroxyl group, while the piperidine ring contributes to its basicity. The compound may participate in various chemical reactions, including esterification and amidation, due to its functional groups. Additionally, 3-Hydroxy-1-piperidineacetic acid may have biological significance, potentially acting as a precursor or intermediate in the synthesis of pharmaceuticals or other bioactive molecules. Its structural features suggest it could interact with biological systems, making it of interest in medicinal chemistry and drug development. However, specific applications and biological activities would require further investigation and validation through empirical studies.

Formula: C₇H₁₃NO₃

InChI: InChI=1S/C7H13NO3/c9-6-2-1-3-8(4-6)5-7(10)11/h6,9H,1-5H2,(H,10,11)

InChI key: InChIKey=FVWNVXIYNYGOAS-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1CC(O)CCC1

Synonyms:

• 2-(3-Hydroxypiperidin-1-yl)acetic acid
• 1-Piperidineacetic acid, 3-hydroxy-
• 3-Hydroxy-1-piperidineacetic acid
• (3-Hydroxy-piperidin-1-yl)-acetic acid