CymitQuimica logo

CAS 1217862-96-8

:

4-Ethyl-N-methyl-2-morpholineethanamine

Description:
4-Ethyl-N-methyl-2-morpholineethanamine, identified by its CAS number 1217862-96-8, is a chemical compound that belongs to the class of morpholine derivatives. This substance features a morpholine ring, which is a six-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of an ethyl group and a methyl group attached to the nitrogen atom contributes to its unique properties. Typically, compounds of this nature exhibit moderate to high solubility in polar solvents due to the presence of the morpholine moiety, which can engage in hydrogen bonding. The amine functional group suggests that it may act as a base and could participate in various chemical reactions, including nucleophilic substitutions. Additionally, morpholine derivatives are often studied for their potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. However, specific biological activity, toxicity, and environmental impact would require further investigation through empirical studies.
Formula:C9H20N2O
InChI:InChI=1S/C9H20N2O/c1-3-11-6-7-12-9(8-11)4-5-10-2/h9-10H,3-8H2,1-2H3
InChI key:InChIKey=CNPAEAMYBMQROY-UHFFFAOYSA-N
SMILES:C(CNC)C1CN(CC)CCO1
Synonyms:
  • 2-Morpholineethanamine, 4-ethyl-N-methyl-
  • 4-Ethyl-N-methyl-2-morpholineethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.