CymitQuimica logo

CAS 1217862-97-9

:

Ethyl α,3,4,5-tetramethyl-1H-pyrazole-1-acetate

Description:
Ethyl α,3,4,5-tetramethyl-1H-pyrazole-1-acetate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features multiple methyl groups attached to the pyrazole ring, contributing to its unique properties, including increased steric hindrance and potential lipophilicity. The presence of the ethyl acetate moiety suggests that it may exhibit ester-like characteristics, which can influence its solubility and reactivity. Ethyl α,3,4,5-tetramethyl-1H-pyrazole-1-acetate may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its specific applications and behavior in chemical reactions would depend on the functional groups present and the overall molecular structure. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its stability and reactivity under different conditions. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C11H18N2O2
InChI:InChI=1S/C11H18N2O2/c1-6-15-11(14)10(5)13-9(4)7(2)8(3)12-13/h10H,6H2,1-5H3
InChI key:InChIKey=DFGZSOORPPQZLA-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(C)N1C(C)=C(C)C(C)=N1
Synonyms:
  • 1H-Pyrazole-1-acetic acid, α,3,4,5-tetramethyl-, ethyl ester
  • Ethyl α,3,4,5-tetramethyl-1H-pyrazole-1-acetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.