CAS 1217862-99-1: N-(2,4-Difluorophenyl)-5-(4-piperidinyl)-1,3,4-thiadiazole-2-carboxamide
Description:N-(2,4-Difluorophenyl)-5-(4-piperidinyl)-1,3,4-thiadiazole-2-carboxamide is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, a carboxamide functional group, and a difluorophenyl moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as potential biological activity and solubility in organic solvents. The presence of the piperidine group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The difluorophenyl substituent may enhance lipophilicity and influence the compound's pharmacokinetic properties. Additionally, the thiadiazole ring is known for its diverse biological activities, including antimicrobial and anti-inflammatory effects. Overall, this compound's characteristics make it a candidate for further investigation in drug development and other applications in the pharmaceutical industry. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C14H14F2N4OS
InChI:InChI=1S/C14H14F2N4OS/c15-9-1-2-11(10(16)7-9)18-12(21)14-20-19-13(22-14)8-3-5-17-6-4-8/h1-2,7-8,17H,3-6H2,(H,18,21)
InChI key:InChIKey=XKVKHAXBBDSVKD-UHFFFAOYSA-N
SMILES:O=C(NC1=CC=C(F)C=C1F)C2=NN=C(S2)C3CCNCC3
- Synonyms:
- N-(2,4-Difluorophenyl)-5-(4-piperidinyl)-1,3,4-thiadiazole-2-carboxamide
- 1,3,4-Thiadiazole-2-carboxamide, N-(2,4-difluorophenyl)-5-(4-piperidinyl)-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | N-(2,4-difluorophenyl)-5-piperidin-4-yl-1,3,4-thiadiazole-2-carboxamide REF: 10-F369852CAS: 1217862-99-1 | - - - | - - - | Discontinued product |
 | N-(2,4-Difluorophenyl)-5-piperidin-4-yl-1,3,4-thiadiazole-2-carboxamide REF: 3D-FD123174CAS: 1217862-99-1 | Min. 95% | - - - | Discontinued product |
N-(2,4-difluorophenyl)-5-piperidin-4-yl-1,3,4-thiadiazole-2-carboxamide
Ref: 10-F369852
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information |
N-(2,4-Difluorophenyl)-5-piperidin-4-yl-1,3,4-thiadiazole-2-carboxamide
Ref: 3D-FD123174
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
