CAS 1217863-04-1
:5-Amino-2-(3-fluorophenyl)-4-oxazolecarboxamide
Description:
5-Amino-2-(3-fluorophenyl)-4-oxazolecarboxamide is a chemical compound characterized by its unique structure, which includes an oxazole ring, an amino group, and a fluorophenyl substituent. The presence of the oxazole ring contributes to its potential biological activity, as heterocycles often play significant roles in medicinal chemistry. The amino group can participate in hydrogen bonding, enhancing its solubility and reactivity. The 3-fluorophenyl moiety introduces a fluorine atom, which can influence the compound's electronic properties and lipophilicity, potentially affecting its pharmacokinetics and interactions with biological targets. This compound may exhibit various properties, including potential antimicrobial or anticancer activities, making it of interest in pharmaceutical research. Its specific applications and efficacy would depend on further studies, including in vitro and in vivo evaluations. As with many chemical substances, safety data and handling precautions are essential for laboratory work involving this compound.
Formula:C10H8FN3O2
InChI:InChI=1S/C10H8FN3O2/c11-6-3-1-2-5(4-6)10-14-7(8(12)15)9(13)16-10/h1-4H,13H2,(H2,12,15)
InChI key:InChIKey=BSNOBRWMGRECQS-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1N=C(OC1N)C2=CC(F)=CC=C2
Synonyms:- 5-Amino-2-(3-fluorophenyl)-4-oxazolecarboxamide
- 4-Oxazolecarboxamide, 5-amino-2-(3-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.