CAS 1217863-07-4

Ethyl 4-ethyl-α,3,5-trimethyl-1H-pyrazole-1-acetate

Description:

Ethyl 4-ethyl-α,3,5-trimethyl-1H-pyrazole-1-acetate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features multiple alkyl substituents, specifically ethyl and trimethyl groups, which contribute to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the acetate functional group suggests it may exhibit moderate polarity, influencing its solubility in various organic solvents. Ethyl 4-ethyl-α,3,5-trimethyl-1H-pyrazole-1-acetate may have applications in organic synthesis, potentially serving as an intermediate in the production of pharmaceuticals or agrochemicals. Its specific reactivity and stability would depend on the conditions under which it is handled, including temperature and the presence of other reactive species. As with many pyrazole derivatives, it may also exhibit biological activity, warranting further investigation into its potential uses in medicinal chemistry.

Formula: C₁₂H₂₀N₂O₂

InChI: InChI=1S/C12H20N2O2/c1-6-11-8(3)13-14(9(11)4)10(5)12(15)16-7-2/h10H,6-7H2,1-5H3

InChI key: InChIKey=YTGIDAVTNPREAJ-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)(C)N1C(C)=C(CC)C(C)=N1

Synonyms:

• 1H-Pyrazole-1-acetic acid, 4-ethyl-α,3,5-trimethyl-, ethyl ester
• Ethyl 4-ethyl-α,3,5-trimethyl-1H-pyrazole-1-acetate