CAS 1217863-09-6
:Ethyl 7-cyclopropyl-1,2,3,4-tetrahydro-1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-5-carboxylate
Description:
Ethyl 7-cyclopropyl-1,2,3,4-tetrahydro-1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-5-carboxylate is a complex organic compound characterized by its unique bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and includes a cyclopropyl group, which contributes to its structural rigidity and potential reactivity. The presence of two carbonyl groups (dioxo) suggests that it may exhibit significant reactivity, particularly in nucleophilic addition reactions. The ethyl ester functional group indicates that it may be soluble in organic solvents and could participate in esterification or hydrolysis reactions. Additionally, the compound's intricate structure may confer specific biological activities, making it of interest in medicinal chemistry. Its CAS number, 1217863-09-6, allows for precise identification and retrieval of information regarding its properties, synthesis, and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C14H15N3O4
InChI:InChI=1S/C14H15N3O4/c1-3-21-13(19)8-6-9(7-4-5-7)15-11-10(8)12(18)16-14(20)17(11)2/h6-7H,3-5H2,1-2H3,(H,16,18,20)
InChI key:InChIKey=HAQNRMKBCZSDCI-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C2C(=NC(=C1)C3CC3)N(C)C(=O)NC2=O
Synonyms:- Ethyl 7-cyclopropyl-1,2,3,4-tetrahydro-1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-5-carboxylate
- Pyrido[2,3-d]pyrimidine-5-carboxylic acid, 7-cyclopropyl-1,2,3,4-tetrahydro-1-methyl-2,4-dioxo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.