CAS 1217863-44-9

2,2,6-Trimethyl-3,5-decanedione

Description:

2,2,6-Trimethyl-3,5-decanedione, identified by its CAS number 1217863-44-9, is an organic compound characterized by its diketone structure, featuring two carbonyl (C=O) groups flanked by a long carbon chain. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and exhibits moderate volatility. The presence of multiple methyl groups contributes to its branched structure, influencing its physical properties such as boiling point and melting point. 2,2,6-Trimethyl-3,5-decanedione is known for its potential applications in organic synthesis, particularly as a building block in the production of various chemical intermediates and pharmaceuticals. Additionally, it may exhibit interesting reactivity due to the presence of the diketone functional groups, allowing for various chemical transformations. Safety data should be consulted for handling, as diketones can pose health risks if inhaled or ingested. Overall, this compound is of interest in both industrial and research settings due to its unique structural features and reactivity.

Formula: C₁₃H₂₄O₂

InChI: InChI=1S/C13H24O2/c1-6-7-8-10(2)11(14)9-12(15)13(3,4)5/h10H,6-9H2,1-5H3

InChI key: InChIKey=UYSHBHBHDVSKBL-UHFFFAOYSA-N

SMILES: C(C(C)(C)C)(CC(C(CCCC)C)=O)=O

Synonyms:

• 3,5-Decanedione, 2,2,6-trimethyl-
• 2,2,6-Trimethyl-3,5-decanedione