CymitQuimica logo

CAS 1217863-53-0

:

2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4-phenyl-3-thiophenecarboxylic acid

Description:
2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4-phenyl-3-thiophenecarboxylic acid, with CAS number 1217863-53-0, is a synthetic organic compound characterized by its complex structure, which includes a thiophene ring, a phenyl group, and a fluorenylmethoxycarbonyl (Fmoc) protecting group. This compound is typically used in peptide synthesis and other organic synthesis applications due to its ability to protect amino groups during chemical reactions. The presence of the thiophene moiety contributes to its potential biological activity, making it of interest in medicinal chemistry. The Fmoc group allows for selective deprotection under mild basic conditions, facilitating the stepwise assembly of peptides. Additionally, the carboxylic acid functional group provides acidity and can participate in various chemical reactions, including esterification and amidation. Overall, this compound exemplifies the intersection of organic synthesis and medicinal chemistry, showcasing the utility of protecting groups and functionalized aromatic systems in complex molecule construction.
Formula:C26H19NO4S
InChI:InChI=1S/C26H19NO4S/c28-25(29)23-22(16-8-2-1-3-9-16)15-32-24(23)27-26(30)31-14-21-19-12-6-4-10-17(19)18-11-5-7-13-20(18)21/h1-13,15,21H,14H2,(H,27,30)(H,28,29)
InChI key:InChIKey=WMIQPALHWPEGOZ-UHFFFAOYSA-N
SMILES:C(OC(NC1=C(C(O)=O)C(=CS1)C2=CC=CC=C2)=O)C3C=4C(C=5C3=CC=CC5)=CC=CC4
Synonyms:
  • 3-Thiophenecarboxylic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-4-phenyl-
  • 2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4-phenyl-3-thiophenecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.