CymitQuimica logo

CAS 1217863-68-7

:

2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-5-methyl-4-phenyl-3-thiophenecarboxylic acid

Description:
The chemical substance known as 2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-5-methyl-4-phenyl-3-thiophenecarboxylic acid, with the CAS number 1217863-68-7, is a complex organic compound characterized by its unique structural features. It contains a thiophene ring, which contributes to its aromatic properties, and a fluorenylmethoxycarbonyl (Fmoc) group, commonly used in peptide synthesis as a protective group for amino acids. The presence of multiple functional groups, including an amino group and a carboxylic acid, suggests that this compound may exhibit both acidic and basic properties, making it potentially useful in various chemical reactions and applications. Its molecular structure indicates potential for interactions in biological systems, possibly serving as a building block in drug development or materials science. The compound's solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it important to consider these factors in practical applications. Overall, this compound represents a versatile structure with implications in organic synthesis and medicinal chemistry.
Formula:C27H21NO4S
InChI:InChI=1S/C27H21NO4S/c1-16-23(17-9-3-2-4-10-17)24(26(29)30)25(33-16)28-27(31)32-15-22-20-13-7-5-11-18(20)19-12-6-8-14-21(19)22/h2-14,22H,15H2,1H3,(H,28,31)(H,29,30)
InChI key:InChIKey=DIYPYHHQIAPIME-UHFFFAOYSA-N
SMILES:C(OC(NC1=C(C(O)=O)C(=C(C)S1)C2=CC=CC=C2)=O)C3C=4C(C=5C3=CC=CC5)=CC=CC4
Synonyms:
  • 2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-5-methyl-4-phenyl-3-thiophenecarboxylic acid
  • 3-Thiophenecarboxylic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-5-methyl-4-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.