CAS 121789-32-0

3-Bromo-2-methoxybenzoyl chloride

Description:

3-Bromo-2-methoxybenzoyl chloride is an organic compound characterized by its functional groups, which include a bromine atom, a methoxy group, and an acyl chloride. This compound features a benzene ring substituted at the 3-position with a bromine atom and at the 2-position with a methoxy group, along with a carbonyl group attached to a chlorine atom, making it a benzoyl chloride derivative. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the acyl chloride group indicates that it is reactive, particularly with nucleophiles, making it useful in various synthetic applications, including the preparation of esters and amides. Additionally, the bromine substituent can participate in further reactions, such as cross-coupling reactions, enhancing its utility in organic synthesis. Due to its reactivity, appropriate safety measures should be taken when handling this compound, as it can be corrosive and may release harmful gases upon contact with moisture.

Formula: C₈H₆BrClO₂

InChI: InChI=1S/C8H6BrClO2/c1-12-7-5(8(10)11)3-2-4-6(7)9/h2-4H,1H3

InChI key: InChIKey=ZWBHCTHYSGCKIU-UHFFFAOYSA-N

SMILES: O(C)C1=C(C(Cl)=O)C=CC=C1Br

Synonyms:

• 3-Bromo-2-methoxybenzoyl chloride
• Benzoyl chloride, 3-bromo-2-methoxy-