CymitQuimica logo

CAS 121789-35-3

:

3-(1,3-dioxan-2-yl)-1-(3-methoxyphenyl)propan-1-one

Description:
3-(1,3-Dioxan-2-yl)-1-(3-methoxyphenyl)propan-1-one, with the CAS number 121789-35-3, is an organic compound characterized by its unique structural features, including a dioxane ring and a methoxy-substituted phenyl group. This compound typically exhibits a molecular structure that includes a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the dioxane moiety may impart certain solubility characteristics, making it more soluble in polar solvents. Additionally, the methoxy group can influence the compound's electronic properties, potentially affecting its reactivity and interaction with biological systems. Such compounds are often studied for their potential use in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific physical properties, such as melting point, boiling point, and spectral characteristics, would need to be determined experimentally, as they can vary based on purity and environmental conditions. Overall, this compound represents a class of organic molecules with diverse applications in chemical research and industry.
Formula:C14H18O4
InChI:InChI=1/C14H18O4/c1-16-12-5-2-4-11(10-12)13(15)6-7-14-17-8-3-9-18-14/h2,4-5,10,14H,3,6-9H2,1H3
SMILES:COc1cccc(c1)C(=O)CCC1OCCCO1
Synonyms:
  • 1-Propanone, 3-(1,3-Dioxan-2-Yl)-1-(3-Methoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.