CAS 121789-38-6
:3-(1,3-dioxan-2-yl)-1-(4-methoxyphenyl)propan-1-one
Description:
3-(1,3-Dioxan-2-yl)-1-(4-methoxyphenyl)propan-1-one, with the CAS number 121789-38-6, is an organic compound characterized by its unique structural features, including a dioxane ring and a methoxy-substituted phenyl group. This compound typically exhibits a molecular structure that includes a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the dioxane moiety suggests that it may possess properties such as solubility in polar solvents and potential stability under various conditions. Additionally, the methoxy group can influence the compound's electronic properties, potentially affecting its reactivity and interactions with other molecules. This compound may be of interest in fields such as medicinal chemistry, where derivatives are often explored for biological activity. However, specific physical properties like melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications and handling guidelines.
Formula:C14H18O4
InChI:InChI=1/C14H18O4/c1-16-12-5-3-11(4-6-12)13(15)7-8-14-17-9-2-10-18-14/h3-6,14H,2,7-10H2,1H3
SMILES:COc1ccc(cc1)C(=O)CCC1OCCCO1
Synonyms:- 1-Propanone, 3-(1,3-Dioxan-2-Yl)-1-(4-Methoxyphenyl)-
- 3-(1,3-Dioxan-2-yl)-1-(4-methoxyphenyl)propan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
