CymitQuimica logo

CAS 1218-80-0

:

6-BROMOFLAVONE

Description:
6-Bromoflavone is a synthetic compound belonging to the flavonoid class of chemicals, characterized by its distinctive flavone backbone with a bromine atom substituted at the 6-position. This compound is typically a yellow crystalline solid, exhibiting moderate solubility in organic solvents such as ethanol and dimethyl sulfoxide, while being less soluble in water. 6-Bromoflavone is known for its potential biological activities, including antioxidant properties and the ability to modulate various enzymatic pathways, making it of interest in pharmacological research. Its molecular structure contributes to its reactivity and interaction with biological systems, which can lead to various applications in medicinal chemistry and biochemistry. Additionally, it may serve as a useful tool in studying flavonoid-related mechanisms in cellular processes. As with many brominated compounds, safety precautions should be taken when handling 6-bromoflavone due to potential toxicity and environmental concerns associated with halogenated organic compounds.
Formula:C15H9BrO2
InChI:InChI=1/C15H9BrO2/c16-11-6-7-14-12(8-11)13(17)9-15(18-14)10-4-2-1-3-5-10/h1-9H
SMILES:c1ccc(cc1)c1cc(=O)c2cc(ccc2o1)Br
Synonyms:
  • 6-Bromo-2-Phenyl-4H-Chromen-4-One
  • 6-Bromo-2-Phenyl-(4H)-4-Benzopyranone
  • 6-Bromo-2-phenyl-4H-1-benzopyran-4-one, 6-Bromoflavone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.