CAS 1218-89-9
:4,4'-dimethylbenzoin
Description:
4,4'-Dimethylbenzoin is an organic compound characterized by its structure, which features two benzene rings connected by a carbonyl group (C=O) and two methyl groups attached to the para positions of one of the benzene rings. This compound is typically a white to pale yellow crystalline solid, exhibiting moderate solubility in organic solvents such as ethanol and acetone, but limited solubility in water. It is known for its role as a photoinitiator in polymerization processes, particularly in UV-curable coatings and adhesives. The presence of the carbonyl group contributes to its reactivity, allowing it to participate in various chemical reactions, including oxidation and reduction. Additionally, 4,4'-dimethylbenzoin can undergo rearrangements and is often utilized in synthetic organic chemistry as an intermediate in the preparation of other chemical compounds. Safety data indicates that it should be handled with care, as with many organic compounds, due to potential irritant properties.
Formula:C16H16O2
InChI:InChI=1/C16H16O2/c1-11-3-7-13(8-4-11)15(17)16(18)14-9-5-12(2)6-10-14/h3-10,15,17H,1-2H3
SMILES:Cc1ccc(cc1)C(C(=O)c1ccc(C)cc1)O
Synonyms:- Dimethylbenzoin
- 2-Hydroxy-1,2-Bis(4-Methylphenyl)Ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4,4'-Dimethylbenzoin
CAS:Formula:C16H16O2Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:240.30Ethanone, 2-hydroxy-1,2-bis(4-methylphenyl)-
CAS:Formula:C16H16O2Purity:95%Color and Shape:SolidMolecular weight:240.29704,4'-Dimethylbenzoin
CAS:4,4'-Dimethylbenzoin is a compound that has been shown to inhibit the growth of cancer cells and act as an antibacterial agent. It is synthesized by the copolymerization of formaldehyde and 4,4'-dimethoxybenzoyl chloride in the presence of sodium chloride. The synthesis is catalyzed by potassium methoxide. 4,4'-Dimethylbenzoin can be used as a starting material for the synthesis of other organic compounds. It can also be used as a solvent in chromatographic methods.Formula:C16H16O2Purity:Min. 95%Color and Shape:PowderMolecular weight:240.3 g/mol




