CymitQuimica logo

CAS 121806-49-3

:

N-(2,6-Dichlorophenyl)-2,2,2-trifluoroacetamide

Description:
N-(2,6-Dichlorophenyl)-2,2,2-trifluoroacetamide is an organic compound characterized by its distinctive functional groups and halogenated aromatic structure. It features a dichlorophenyl moiety, which contributes to its hydrophobic properties and potential biological activity. The trifluoroacetamide group enhances its stability and lipophilicity, making it relevant in various chemical applications, including agrochemicals and pharmaceuticals. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical structure suggests potential interactions with biological systems, which could be explored for herbicidal or pesticidal properties. Additionally, the presence of chlorine and fluorine atoms can influence its reactivity and environmental persistence. Safety data should be consulted for handling and exposure risks, as halogenated compounds can pose environmental and health concerns. Overall, N-(2,6-Dichlorophenyl)-2,2,2-trifluoroacetamide is a notable compound in the realm of synthetic organic chemistry, with implications for both research and practical applications.
Formula:C8H4Cl2F3NO
InChI:InChI=1S/C8H4Cl2F3NO/c9-4-2-1-3-5(10)6(4)14-7(15)8(11,12)13/h1-3H,(H,14,15)
InChI key:InChIKey=HRYRWIBTOQREID-UHFFFAOYSA-N
SMILES:N(C(C(F)(F)F)=O)C1=C(Cl)C=CC=C1Cl
Synonyms:
  • Acetamide, N-(2,6-dichlorophenyl)-2,2,2-trifluoro-
  • N-(2,6-Dichlorophenyl)-2,2,2-trifluoroacetamide
  • N-(2,6-Dichlorophenyl)-2,2,2-[fluoro]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.