CAS 121816-80-6
:N,N-Dimethyl-2-nitro-1H-imidazole-1-sulfonamide
Description:
N,N-Dimethyl-2-nitro-1H-imidazole-1-sulfonamide, with the CAS number 121816-80-6, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a nitro group (-NO2) and a sulfonamide group (-SO2NH2) attached to the imidazole ring, contributing to its unique chemical properties. The presence of the dimethyl groups indicates that there are two methyl groups attached to the nitrogen atom of the sulfonamide, enhancing its solubility and reactivity. This compound is often studied for its potential biological activities, including antimicrobial and antifungal properties, due to the functional groups present. Its molecular structure allows for various interactions with biological targets, making it of interest in medicinal chemistry. Additionally, it is important to handle this compound with care, as nitro and sulfonamide groups can exhibit specific reactivity and toxicity profiles.
Formula:C5H8N4O4S
InChI:InChI=1S/C5H8N4O4S/c1-7(2)14(12,13)8-4-3-6-5(8)9(10)11/h3-4H,1-2H3
InChI key:InChIKey=IKIRODUWLINOTO-UHFFFAOYSA-N
SMILES:S(N(C)C)(=O)(=O)N1C(N(=O)=O)=NC=C1
Synonyms:- N,N-Dimethyl-2-nitro-1H-imidazole-1-sulfonamide
- 1H-Imidazole-1-sulfonamide, N,N-dimethyl-2-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
