CAS 121816-84-0
:4-BROMO-2-NITRO-1H-IMIDAZOLE
Description:
4-Bromo-2-nitro-1H-imidazole is a heterocyclic organic compound characterized by the presence of both bromine and nitro functional groups attached to an imidazole ring. This compound typically exhibits a pale yellow to brownish appearance and is soluble in polar organic solvents. The imidazole ring contributes to its basicity and potential reactivity, making it a useful intermediate in various chemical syntheses, particularly in pharmaceuticals and agrochemicals. The presence of the bromine atom enhances its electrophilic properties, while the nitro group can serve as a versatile handle for further chemical modifications. Additionally, 4-bromo-2-nitro-1H-imidazole may exhibit biological activity, which has been explored in medicinal chemistry. Its stability under standard laboratory conditions allows for a range of applications, including use in organic synthesis and as a building block for more complex molecules. Safety precautions should be taken when handling this compound, as it may pose health risks due to its chemical nature.
Formula:C3H2BrN3O2
InChI:InChI=1/C3H2BrN3O2/c4-2-1-5-3(6-2)7(8)9/h1H,(H,5,6)
SMILES:c1c(Br)[nH]c(n1)N(=O)=O
Synonyms:- 1H-imidazole, 4-bromo-2-nitro-
- 4-Bromo-2-nitro-1H-imidazole
- 1H-Imidazole, 5-bromo-2-nitro-
- 5-bromo-2-nitro-1H-Imidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Imidazole, 5-bromo-2-nitro-
CAS:Formula:C3H2BrN3O2Purity:97%Color and Shape:SolidMolecular weight:191.97094-Bromo-2-nitro-1H-imidazole
CAS:Formula:C3H2BrN3O2Purity:97%Color and Shape:SolidMolecular weight:191.9724-Bromo-2-nitro-1H-imidazole
CAS:4-Bromo-2-nitro-1H-imidazole (4BNI) is a synthetic drug that is used in the treatment of cancer. 4BNI inhibits the synthesis of DNA, which leads to cell death by preventing the production of proteins vital for cell division. When 4BNI is taken up by cells it becomes activated and binds to DNA, inhibiting the synthesis of RNA and protein. This process eventually leads to apoptosis (cell death). 4BNI has been shown to be effective against tumors in mice, but has not yet been tested on humans. The uptake of 4BNI in tumor tissue can be visualized using hypoxia imaging techniques such as positron emission tomography or magnetic resonance imaging.
Formula:C3H2BrN3O2Purity:Min. 95%Color and Shape:PowderMolecular weight:191.97 g/mol



