CymitQuimica logo

CAS 121823-85-6

:

diethyl 2-isopentyl-2-methylmalonate

Description:
Diethyl 2-isopentyl-2-methylmalonate is an organic compound characterized by its structure, which includes two ethyl ester groups and a branched alkyl chain. This compound belongs to the class of malonic acid derivatives, specifically malonates, which are known for their utility in organic synthesis, particularly in the formation of carbon-carbon bonds. The presence of the isopentyl and methyl groups contributes to its steric properties and may influence its reactivity and solubility. Typically, malonates exhibit a range of chemical behaviors, including nucleophilic substitution and condensation reactions, making them valuable intermediates in the synthesis of various pharmaceuticals and agrochemicals. The compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Safety data sheets would provide information on its handling, storage, and potential hazards, emphasizing the importance of proper laboratory practices when working with such chemical substances.
Formula:C13H24O4
InChI:InChI=1/C13H24O4/c1-6-16-11(14)13(5,9-8-10(3)4)12(15)17-7-2/h10H,6-9H2,1-5H3
SMILES:CCOC(=O)C(C)(CCC(C)C)C(=O)OCC
Synonyms:
  • Diethyl Methyl(3-Methylbutyl)Propanedioate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.