CAS 12183-63-0
:Germanate (GeO32-), diammonium
Description:
Diammonium germanate, with the chemical formula (NH4)2GeO3, is a compound that features the germanate ion (GeO3)2- combined with ammonium ions (NH4+). This substance is characterized by its crystalline structure and is typically found as a white or colorless solid. It is soluble in water, which allows it to participate in various chemical reactions, particularly in the synthesis of germanium-containing materials. The compound exhibits properties typical of ammonium salts, including the ability to release ammonia upon heating. Diammonium germanate is of interest in materials science and semiconductor research due to its germanium content, which is a key element in electronics and photonics. Additionally, it can serve as a precursor for the preparation of germanium oxide and other germanium-based compounds. Safety precautions should be taken when handling this substance, as with any chemical, to avoid potential hazards associated with its reactivity and solubility.
Formula:GeO3·2H4N
InChI:InChI=1S/GeO3.2H3N/c2-1(3)4;;/h;2*1H3/q-2;;/p+2
InChI key:InChIKey=APNGRXAWZRFKOF-UHFFFAOYSA-P
SMILES:[Ge-2](=O)(=O)=O.[NH4+]
Synonyms:- Ammonium germanate(IV) ((NH4)2GeO3)
- Germanate (GeO32-), diammonium
- Ammonium germanate ((NH4)2GeO3)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
