CymitQuimica logo

CAS 121845-55-4

:

3-(4-FLUOROPHENYL)PYRIDO[3,4-E][1,2,4]TRIAZINE

Description:
3-(4-Fluorophenyl)pyrido[3,4-e][1,2,4]triazine is a heterocyclic compound characterized by its complex fused ring structure, which includes a pyridine and triazine moiety. The presence of a fluorophenyl group enhances its electronic properties, potentially influencing its reactivity and interactions with biological targets. This compound is typically of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for more complex molecules. Its unique structure may confer specific pharmacological activities, making it a candidate for further investigation in therapeutic contexts. The compound's solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular architecture. Additionally, the fluorine atom can affect lipophilicity and metabolic stability, which are critical factors in drug design. Overall, 3-(4-fluorophenyl)pyrido[3,4-e][1,2,4]triazine represents a significant class of compounds with diverse applications in chemistry and pharmacology.
Formula:C12H7FN4
InChI:InChI=1/C12H7FN4/c13-9-3-1-8(2-4-9)12-15-11-7-14-6-5-10(11)16-17-12/h1-7H
SMILES:c1cc(ccc1c1nc2cnccc2nn1)F
Synonyms:
  • 3-(4-Fluoro-phenyl)-pyrido(3,4-e)(1,2,4)triazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.