CAS 121845-59-8

3-(4-(TRIFLUOROMETHYL)PHENYL)PYRIDO[3,4-E][1,2,4]TRIAZINE

Description:

3-(4-(Trifluoromethyl)phenyl)pyrido[3,4-e][1,2,4]triazine is a heterocyclic compound characterized by its complex structure, which includes a pyridine ring fused with a triazine moiety. The presence of a trifluoromethyl group on the phenyl ring significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its reactivity and biological activity. This compound is typically of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for more complex molecules. Its unique electronic properties, attributed to the trifluoromethyl group, may also contribute to its utility in various chemical reactions. Additionally, the compound's stability and solubility characteristics can vary based on the solvent and conditions used, making it a subject of interest for further research in both synthetic and applied chemistry contexts. Overall, 3-(4-(trifluoromethyl)phenyl)pyrido[3,4-e][1,2,4]triazine exemplifies the diverse functionalities that can arise from heterocyclic compounds in organic chemistry.

Formula: C₁₃H₇F₃N₄

InChI: InChI=1/C13H7F3N4/c14-13(15,16)9-3-1-8(2-4-9)12-18-11-7-17-6-5-10(11)19-20-12/h1-7H

SMILES: c1cc(ccc1c1nc2cnccc2nn1)C(F)(F)F

Synonyms:

• 3-(4-Trifluoromethyl-phenyl)-pyrido(3,4-e)(1,2,4)triazine

3-(4-(Trifluoromethyl)phenyl)pyrido[3,4-e][1,2,4]triazine

CAS: 121845-59-8

Formula: C₁₃H₇F₃N₄

Molecular weight: 276.2167

Ref: IN-DA00164Z