
CAS 121845-60-1
:4-Pyrido[3,4-e]-1,2,4-triazin-3-ylbenzonitrile
Description:
4-Pyrido[3,4-e]-1,2,4-triazin-3-ylbenzonitrile is a heterocyclic compound characterized by its complex structure, which includes a pyridine ring fused to a triazine moiety and a benzonitrile group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of nitrogen atoms in the triazine ring. It may display interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. The presence of the benzonitrile group can contribute to its lipophilicity, influencing its solubility and permeability in biological systems. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the functional groups present. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science, where its electronic properties and reactivity can be harnessed for specific purposes. Overall, 4-Pyrido[3,4-e]-1,2,4-triazin-3-ylbenzonitrile represents a versatile compound with significant potential in various fields of research.
Formula:C13H7N5
InChI:InChI=1S/C13H7N5/c14-7-9-1-3-10(4-2-9)13-16-12-8-15-6-5-11(12)17-18-13/h1-6,8H
InChI key:InChIKey=KVYRBRIPUAHYGR-UHFFFAOYSA-N
SMILES:C(#N)C1=CC=C(C2=NC3=C(N=N2)C=CN=C3)C=C1
Synonyms:- 4-Pyrido[3,4-e]-1,2,4-triazin-3-ylbenzonitrile
- Benzonitrile, 4-pyrido[3,4-e]-1,2,4-triazin-3-yl-
- Pyrido[3,4-e]-1,2,4-triazine, benzonitrile deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
