
CAS 121845-61-2
:3-[1,1′-Biphenyl]-4-ylpyrido[3,4-e]-1,2,4-triazine
Description:
3-[1,1′-Biphenyl]-4-ylpyrido[3,4-e]-1,2,4-triazine is a heterocyclic organic compound characterized by its complex structure, which includes a biphenyl moiety and a pyrido-triazine framework. This compound features a triazine ring fused with a pyridine ring, contributing to its aromatic properties and potential electronic characteristics. The presence of the biphenyl group enhances its stability and may influence its solubility and reactivity. Typically, compounds of this nature exhibit interesting photophysical properties, making them candidates for applications in organic electronics, such as organic light-emitting diodes (OLEDs) and organic photovoltaics. Additionally, the unique arrangement of nitrogen and carbon atoms in the triazine structure can impart specific biological activities, potentially making it relevant in medicinal chemistry. Its synthesis often involves multi-step organic reactions, and its characterization can be performed using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography to confirm its structure and purity.
Formula:C18H12N4
InChI:InChI=1S/C18H12N4/c1-2-4-13(5-3-1)14-6-8-15(9-7-14)18-20-17-12-19-11-10-16(17)21-22-18/h1-12H
InChI key:InChIKey=HYRXSBPCRFQPQZ-UHFFFAOYSA-N
SMILES:C1(=NC2=C(N=N1)C=CN=C2)C3=CC=C(C=C3)C4=CC=CC=C4
Synonyms:- Pyrido[3,4-e]-1,2,4-triazine, 3-[1,1′-biphenyl]-4-yl-
- 3-[1,1′-Biphenyl]-4-ylpyrido[3,4-e]-1,2,4-triazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
