
CAS 1218686-35-1
:2-(1-Ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-4-thiazolidinecarboxylic acid
Description:
2-(1-Ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-4-thiazolidinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a thiazolidine ring and a pyrazole moiety. The presence of the thiazolidine ring suggests potential biological activity, as compounds in this class are often investigated for their pharmacological properties. The ethyl and dimethyl substituents on the pyrazole ring contribute to its lipophilicity, potentially influencing its solubility and permeability in biological systems. This compound may exhibit various functional groups that can participate in chemical reactions, making it a candidate for further synthetic modifications. Its specific stereochemistry and functional groups may also play a crucial role in its reactivity and interactions with biological targets. Overall, the compound's structural complexity and functional diversity suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Further studies would be necessary to elucidate its precise biological activity and potential uses.
Formula:C11H17N3O2S
InChI:InChI=1S/C11H17N3O2S/c1-4-14-7(3)9(6(2)13-14)10-12-8(5-17-10)11(15)16/h8,10,12H,4-5H2,1-3H3,(H,15,16)
InChI key:InChIKey=XTLKSRMOLPDKMM-UHFFFAOYSA-N
SMILES:CC1=C(C2NC(C(O)=O)CS2)C(C)=NN1CC
Synonyms:- 4-Thiazolidinecarboxylic acid, 2-(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-
- 2-(1-Ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-4-thiazolidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.