CAS 121872-95-5

2-Chloro-4,5-difluorobenzoyl chloride

Description:

2-Chloro-4,5-difluorobenzoyl chloride is an organic compound characterized by its aromatic structure, which includes a benzoyl chloride moiety substituted with chlorine and fluorine atoms. The presence of the chloro and difluoro substituents on the benzene ring significantly influences its reactivity and physical properties. This compound typically appears as a colorless to pale yellow liquid and is known for its strong electrophilic nature, making it useful in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. It is also a reactive acyl chloride, which can readily undergo nucleophilic acyl substitution reactions. Due to the presence of halogens, it may exhibit enhanced lipophilicity and biological activity. Safety precautions are essential when handling this compound, as it can be corrosive and may release harmful gases upon hydrolysis. Proper storage in a cool, dry place, away from moisture, is recommended to maintain its stability and prevent degradation.

Formula: C₇H₂Cl₂F₂O

InChI: InChI=1/C7H2Cl2F2O/c8-4-2-6(11)5(10)1-3(4)7(9)12/h1-2H

SMILES: c1c(c(cc(c1F)F)Cl)C(=O)Cl

2-Chloro-4,5-difluorobenzoyl chloride

CAS: 121872-95-5

Formula: C₇H₂Cl₂F₂O

Purity: 95%

Molecular weight: 210.9930

Ref: IN-DA001670

2-Chloro-4,5-difluorobenzoyl chloride

CAS: 121872-95-5

2-Chloro-4,5-difluorobenzoyl chloride

Formula: C₇H₂Cl₂F₂O

Purity: 98%

Color and Shape: clear. colourless liquid

Molecular weight: 210.99g/mol

Ref: 54-PC2598

2-Chloro-4,5-difluoro-benzoyl chloride

CAS: 121872-95-5

Formula: C₇H₂Cl₂F₂O

Color and Shape: Liquid

Molecular weight: 210.99

Ref: 10-F032942