
CAS 1218779-89-5
:3-Pyridinecarboxamide, N-[4-(1-cyanocyclopentyl)phenyl]-2-[(4-pyridinylmethyl)amino]-, hydrochloride (1:1)
Description:
3-Pyridinecarboxamide, N-[4-(1-cyanocyclopentyl)phenyl]-2-[(4-pyridinylmethyl)amino]-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a pyridine ring and various functional groups such as amides and cyano groups. This compound is typically a white to off-white solid and is soluble in polar solvents, which is common for hydrochloride salts. The presence of multiple aromatic rings suggests potential for π-π stacking interactions, which may influence its biological activity and solubility. The compound's structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its hydrochloride form enhances stability and solubility, making it suitable for various formulations. As with many organic compounds, it is essential to handle this substance with care, following appropriate safety protocols due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological properties and mechanisms of action.
Formula:C24H23N5O·ClH
InChI:InChI=1S/C24H23N5O.ClH/c25-17-24(11-1-2-12-24)19-5-7-20(8-6-19)29-23(30)21-4-3-13-27-22(21)28-16-18-9-14-26-15-10-18;/h3-10,13-15H,1-2,11-12,16H2,(H,27,28)(H,29,30);1H
InChI key:InChIKey=YJFMYZMORFXPKW-UHFFFAOYSA-N
SMILES:C(#N)C1(CCCC1)C2=CC=C(NC(=O)C3=C(NCC=4C=CN=CC4)N=CC=C3)C=C2.Cl
Synonyms:- Apatinib hydrochloride
- 3-Pyridinecarboxamide, N-[4-(1-cyanocyclopentyl)phenyl]-2-[(4-pyridinylmethyl)amino]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Apatinib HC
CAS:Rivoceranib/Apatinib (YN-968D1) is an oral tyrosine kinase inhibitor that targets VEGFR2, c-Kit, and c-SRC to combat cancer.Formula:C24H24ClN5OColor and Shape:SolidMolecular weight:433.94
