CymitQuimica logo

CAS 1218789-37-7

:

2,2,2-Trifluoro-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrimidinyl]acetamide

Description:
2,2,2-Trifluoro-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrimidinyl]acetamide is a chemical compound characterized by its complex structure, which includes a trifluoroacetamide group and a pyrimidine moiety substituted with a boron-containing dioxaborolane. The presence of trifluoromethyl groups imparts unique electronic properties, enhancing its potential as a bioactive molecule. The dioxaborolane unit is known for its ability to form stable complexes with various substrates, making this compound of interest in medicinal chemistry and material science. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways due to the pyrimidine ring's role in biological activity. Additionally, the compound's stability and reactivity can be influenced by the presence of the boron atom, which may facilitate further chemical transformations. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, highlighting the importance of functional groups in determining the properties and applications of chemical substances.
Formula:C12H15BF3N3O3
InChI:InChI=1S/C12H15BF3N3O3/c1-10(2)11(3,4)22-13(21-10)7-5-17-9(18-6-7)19-8(20)12(14,15)16/h5-6H,1-4H3,(H,17,18,19,20)
InChI key:InChIKey=UWWLIVCPXPFZCP-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=NC(NC(C(F)(F)F)=O)=NC2
Synonyms:
  • 2,2,2-Trifluoro-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrimidinyl]acetamide
  • Acetamide, 2,2,2-trifluoro-N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrimidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.