CymitQuimica logo

CAS 1218789-84-4

:

2-[3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-5-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
2-[3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-5-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a complex organic compound characterized by its unique structural features, including a dioxaborolane ring and a silyl ether moiety. The presence of the dioxaborolane functional group suggests potential applications in organic synthesis, particularly in cross-coupling reactions, due to its ability to act as a boron source. The bulky tert-butyl and dimethylsilyl groups contribute to its steric hindrance, which can influence its reactivity and solubility in various solvents. Additionally, the methylphenyl substituent may enhance its stability and affect its electronic properties. This compound is likely to be of interest in materials science and medicinal chemistry, where boron-containing compounds are often utilized for their unique reactivity and ability to form stable complexes. Overall, its intricate structure and functional groups suggest a versatile compound with potential applications in various chemical processes.
Formula:C19H33BO3Si
InChI:InChI=1S/C19H33BO3Si/c1-14-11-15(20-22-18(5,6)19(7,8)23-20)13-16(12-14)21-24(9,10)17(2,3)4/h11-13H,1-10H3
InChI key:InChIKey=UEEPPRPYENTHLY-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(O[Si](C(C)(C)C)(C)C)=CC(C)=C2
Synonyms:
  • 1,3,2-Dioxaborolane, 2-[3-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-5-methylphenyl]-4,4,5,5-tetramethyl-
  • 2-[3-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]-5-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.